C17H26O5 — CID 10662735
[(3S)-6-methylhepta-1,6-dien-3-yl] 2-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetate (PubChem CID 10662735) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(3S)-6-methylhepta-1,6-dien-3-yl] 2-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetate.
| Compound Name | [(3S)-6-methylhepta-1,6-dien-3-yl] 2-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 10662735 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(3S)-6-methylhepta-1,6-dien-3-yl] 2-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| SMILES | C=C[C@H](CCC(=C)C)OC(=O)C[C@@H]1O[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C17H26O5/c1-7-12(9-8-11(2)3)20-14(18)10-13-15(19)22-16(21-13)17(4,5)6/h7,12-13,16H,1-2,8-10H2,3-6H3/t12-,13+,16+/m1/s1 |
| InChIKey | DLSSBVAOMBGMSN-WWGRRREGSA-N |
| XLogP | 3.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|