C15H16Cl2N2O2 — CID 10663928
3-(tert-butylamino)-4-[(2,4-dichlorophenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 10663928) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 3-(tert-butylamino)-4-[(2,4-dichlorophenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(tert-butylamino)-4-[(2,4-dichlorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10663928 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-(tert-butylamino)-4-[(2,4-dichlorophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)Nc1c(NCc2ccc(Cl)cc2Cl)c(=O)c1=O |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-15(2,3)19-12-11(13(20)14(12)21)18-7-8-4-5-9(16)6-10(8)17/h4-6,18-19H,7H2,1-3H3 |
| InChIKey | SFBZHIWEHIXYLJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|