C20H15Cl2N3O2 — CID 130448087
3-[(2,4-dichlorophenyl)methylamino]-4-(1H-indol-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 130448087) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylamino]-4-(1H-indol-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2,4-dichlorophenyl)methylamino]-4-(1H-indol-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 130448087 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylamino]-4-(1H-indol-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2cc3ccccc3[nH]2)c(NCc2ccc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C20H15Cl2N3O2/c21-13-6-5-12(15(22)8-13)9-23-17-18(20(27)19(17)26)24-10-14-7-11-3-1-2-4-16(11)25-14/h1-8,23-25H,9-10H2 |
| InChIKey | GFEFIMZJNVJJLF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|