C17H22O7 — CID 10664728
[(1R)-1-[(3aS,4S,7R,7aR)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4-yl]-3-(1,3-dioxolan-2-yl)propyl] acetate (PubChem CID 10664728) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is [(1R)-1-[(3aS,4S,7R,7aR)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4-yl]-3-(1,3-dioxolan-2-yl)propyl] acetate.
| Compound Name | [(1R)-1-[(3aS,4S,7R,7aR)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4-yl]-3-(1,3-dioxolan-2-yl)propyl] acetate |
|---|---|
| PubChem CID | 10664728 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(1R)-1-[(3aS,4S,7R,7aR)-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4-yl]-3-(1,3-dioxolan-2-yl)propyl] acetate |
| SMILES | CC(=O)O[C@H](CCC1OCCO1)[C@H]1C=C[C@@H](C)[C@H]2C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C17H22O7/c1-9-3-4-11(15-14(9)16(19)24-17(15)20)12(23-10(2)18)5-6-13-21-7-8-22-13/h3-4,9,11-15H,5-8H2,1-2H3/t9-,11-,12-,14-,15+/m1/s1 |
| InChIKey | PTNUNMGGYKNPCG-SYZWTGEBSA-N |
| XLogP | 1.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|