C19H34O3Si — CID 10664778
prop-2-enyl (E,2S,3R)-5-cyclohexyl-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate (PubChem CID 10664778) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is prop-2-enyl (E,2S,3R)-5-cyclohexyl-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate.
| Compound Name | prop-2-enyl (E,2S,3R)-5-cyclohexyl-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate |
|---|---|
| PubChem CID | 10664778 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | prop-2-enyl (E,2S,3R)-5-cyclohexyl-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@H](O)/C=C/C1CCCCC1)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C19H34O3Si/c1-6-14-22-19(21)18(15(2)23(3,4)5)17(20)13-12-16-10-8-7-9-11-16/h6,12-13,15-18,20H,1,7-11,14H2,2-5H3/b13-12+/t15-,17-,18+/m1/s1 |
| InChIKey | BZJDFWKFHXRAAQ-ILVVHCEBSA-N |
| XLogP | 4.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|