C23H32O2 — CID 10664895
2-methoxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzaldehyde (PubChem CID 10664895) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-methoxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzaldehyde.
| Compound Name | 2-methoxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzaldehyde |
|---|---|
| PubChem CID | 10664895 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-methoxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzaldehyde |
| SMILES | C=CC/C=C\C/C=C\CCCCCCCc1cccc(OC)c1C=O |
| InChI | InChI=1S/C23H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-21-18-16-19-23(25-2)22(21)20-24/h3,5-6,8-9,16,18-20H,1,4,7,10-15,17H2,2H3/b6-5-,9-8- |
| InChIKey | HTYFDAAIOGXONT-AFJQJTPPSA-N |
| XLogP | 6.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|