C16H24O8 — CID 10665119
methyl (1R,3R,7S,10R)-5,5-diethyl-12,12-dimethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecane-1-carboxylate (PubChem CID 10665119) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is methyl (1R,3R,7S,10R)-5,5-diethyl-12,12-dimethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecane-1-carboxylate.
| Compound Name | methyl (1R,3R,7S,10R)-5,5-diethyl-12,12-dimethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecane-1-carboxylate |
|---|---|
| PubChem CID | 10665119 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | methyl (1R,3R,7S,10R)-5,5-diethyl-12,12-dimethyl-9-oxo-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecane-1-carboxylate |
| SMILES | CCC1(CC)O[C@H]2OC(=O)[C@@H]3OC(C)(C)O[C@]3(C(=O)OC)C[C@H]2O1 |
| InChI | InChI=1S/C16H24O8/c1-6-15(7-2)21-9-8-16(13(18)19-5)10(22-14(3,4)24-16)11(17)20-12(9)23-15/h9-10,12H,6-8H2,1-5H3/t9-,10+,12-,16-/m1/s1 |
| InChIKey | DYGOTRZTBSQDGL-DXCMXYRUSA-N |
| XLogP | 1.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |