C13H19FO6 — CID 10661151
(1R,3R,7S,10R)-3-(fluoromethyl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one (PubChem CID 10661151) has the molecular formula C13H19FO6 and a molecular weight of 290.29 g/mol. Its IUPAC name is (1R,3R,7S,10R)-3-(fluoromethyl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one.
| Compound Name | (1R,3R,7S,10R)-3-(fluoromethyl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
|---|---|
| PubChem CID | 10661151 |
| Molecular Formula | C13H19FO6 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (1R,3R,7S,10R)-3-(fluoromethyl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(CF)OC(C)(C)O[C@H]3OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H19FO6/c1-11(2)17-7-5-13(6-14)10(19-12(3,4)20-13)16-9(15)8(7)18-11/h7-8,10H,5-6H2,1-4H3/t7-,8-,10-,13+/m1/s1 |
| InChIKey | NSONMNVCULERFO-PPJAJKPTSA-N |
| XLogP | 1.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |