C15H24O7 — CID 10591491
(1R,3S,7S,10R)-3-(2-hydroxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one (PubChem CID 10591491) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is (1R,3S,7S,10R)-3-(2-hydroxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one.
| Compound Name | (1R,3S,7S,10R)-3-(2-hydroxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
|---|---|
| PubChem CID | 10591491 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1R,3S,7S,10R)-3-(2-hydroxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(C(C)(C)O)OC(C)(C)O[C@H]3OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H24O7/c1-12(2,17)15-7-8-9(20-13(3,4)19-8)10(16)18-11(15)21-14(5,6)22-15/h8-9,11,17H,7H2,1-6H3/t8-,9-,11-,15-/m1/s1 |
| InChIKey | COUCATUCYSTETB-XBMUNGEKSA-N |
| XLogP | 1.07 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |