C16H26O7 — CID 10568412
(1R,3R,7S,10R)-1-(2-methoxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one (PubChem CID 10568412) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1R,3R,7S,10R)-1-(2-methoxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one.
| Compound Name | (1R,3R,7S,10R)-1-(2-methoxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
|---|---|
| PubChem CID | 10568412 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1R,3R,7S,10R)-1-(2-methoxypropan-2-yl)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
| SMILES | COC(C)(C)[C@@]12C[C@H]3OC(C)(C)O[C@H]3OC(=O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C16H26O7/c1-13(2,18-7)16-8-9-12(22-14(3,4)20-9)19-11(17)10(16)21-15(5,6)23-16/h9-10,12H,8H2,1-7H3/t9-,10+,12-,16-/m1/s1 |
| InChIKey | JDTBTBRPOPRPDU-DXCMXYRUSA-N |
| XLogP | 1.73 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |