C17H28O7 — CID 10545383
(1R,3S,7S,10R)-5,5-diethyl-3-(2-hydroxypropan-2-yl)-12,12-dimethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one (PubChem CID 10545383) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (1R,3S,7S,10R)-5,5-diethyl-3-(2-hydroxypropan-2-yl)-12,12-dimethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one.
| Compound Name | (1R,3S,7S,10R)-5,5-diethyl-3-(2-hydroxypropan-2-yl)-12,12-dimethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
|---|---|
| PubChem CID | 10545383 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1R,3S,7S,10R)-5,5-diethyl-3-(2-hydroxypropan-2-yl)-12,12-dimethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-one |
| SMILES | CCC1(CC)O[C@H]2OC(=O)[C@@H]3OC(C)(C)O[C@@H]3C[C@@]2(C(C)(C)O)O1 |
| InChI | InChI=1S/C17H28O7/c1-7-16(8-2)23-13-17(24-16,14(3,4)19)9-10-11(12(18)20-13)22-15(5,6)21-10/h10-11,13,19H,7-9H2,1-6H3/t10-,11-,13-,17-/m1/s1 |
| InChIKey | YHPYMRORMZVRDM-YAMOITTJSA-N |
| XLogP | 1.85 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |