C13H20F2O2 — CID 106652310
1-(cycloocten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 106652310) has the molecular formula C13H20F2O2 and a molecular weight of 246.30 g/mol. Its IUPAC name is 1-(cycloocten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(cycloocten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 106652310 |
| Molecular Formula | C13H20F2O2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(cycloocten-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)C1=CCCCCCC1 |
| InChI | InChI=1S/C13H20F2O2/c14-13(15)10-17-9-8-12(16)11-6-4-2-1-3-5-7-11/h6,13H,1-5,7-10H2 |
| InChIKey | IPVXVSLGGSTDSL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|