C14H25N — CID 106653530
2-(cyclohexen-1-yl)-2-(2-methylpropyl)pyrrolidine (PubChem CID 106653530) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-2-(2-methylpropyl)pyrrolidine.
| Compound Name | 2-(cyclohexen-1-yl)-2-(2-methylpropyl)pyrrolidine |
|---|---|
| PubChem CID | 106653530 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2-(cyclohexen-1-yl)-2-(2-methylpropyl)pyrrolidine |
| SMILES | CC(C)CC1(C2=CCCCC2)CCCN1 |
| InChI | InChI=1S/C14H25N/c1-12(2)11-14(9-6-10-15-14)13-7-4-3-5-8-13/h7,12,15H,3-6,8-11H2,1-2H3 |
| InChIKey | BJMUXDWYXJBZLM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|