C20H34O3Si — CID 10665590
(1R,4S,5S,9R,12S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one (PubChem CID 10665590) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1R,4S,5S,9R,12S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one.
| Compound Name | (1R,4S,5S,9R,12S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one |
|---|---|
| PubChem CID | 10665590 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1R,4S,5S,9R,12S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one |
| SMILES | C[C@H]1CC=C2[C@@H]3[C@H]1C(=O)O[C@@H]3CC[C@@]2(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O3Si/c1-13-8-9-14-17-15(23-18(21)16(13)17)10-11-20(14,5)12-22-24(6,7)19(2,3)4/h9,13,15-17H,8,10-12H2,1-7H3/t13-,15+,16-,17-,20-/m0/s1 |
| InChIKey | VSCNCUOQJSYASL-GWKKSSCLSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|