C12H18N2S — CID 106657133
cyclohepten-1-yl-(4-methyl-1,3-thiazol-5-yl)methanamine (PubChem CID 106657133) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is cyclohepten-1-yl-(4-methyl-1,3-thiazol-5-yl)methanamine.
| Compound Name | cyclohepten-1-yl-(4-methyl-1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 106657133 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | cyclohepten-1-yl-(4-methyl-1,3-thiazol-5-yl)methanamine |
| SMILES | Cc1ncsc1C(N)C1=CCCCCC1 |
| InChI | InChI=1S/C12H18N2S/c1-9-12(15-8-14-9)11(13)10-6-4-2-3-5-7-10/h6,8,11H,2-5,7,13H2,1H3 |
| InChIKey | KNSQWYBYBONCOI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|