C11H16N2S — CID 82236016
cyclohepten-1-yl(1,3-thiazol-4-yl)methanamine (PubChem CID 82236016) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is cyclohepten-1-yl(1,3-thiazol-4-yl)methanamine.
| Compound Name | cyclohepten-1-yl(1,3-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82236016 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | cyclohepten-1-yl(1,3-thiazol-4-yl)methanamine |
| SMILES | NC(C1=CCCCCC1)c1cscn1 |
| InChI | InChI=1S/C11H16N2S/c12-11(10-7-14-8-13-10)9-5-3-1-2-4-6-9/h5,7-8,11H,1-4,6,12H2 |
| InChIKey | ICVNRUPDLCMVIY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|