C10H15N3 — CID 82236067
cyclohexen-1-yl(1H-pyrazol-4-yl)methanamine (PubChem CID 82236067) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is cyclohexen-1-yl(1H-pyrazol-4-yl)methanamine.
| Compound Name | cyclohexen-1-yl(1H-pyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82236067 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | cyclohexen-1-yl(1H-pyrazol-4-yl)methanamine |
| SMILES | NC(C1=CCCCC1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H15N3/c11-10(9-6-12-13-7-9)8-4-2-1-3-5-8/h4,6-7,10H,1-3,5,11H2,(H,12,13) |
| InChIKey | RICPPXQIWZNBDP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|