C15H21N — CID 62078316
cyclohexen-1-yl-(3,5-dimethylphenyl)methanamine (PubChem CID 62078316) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is cyclohexen-1-yl-(3,5-dimethylphenyl)methanamine.
| Compound Name | cyclohexen-1-yl-(3,5-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 62078316 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | cyclohexen-1-yl-(3,5-dimethylphenyl)methanamine |
| SMILES | Cc1cc(C)cc(C(N)C2=CCCCC2)c1 |
| InChI | InChI=1S/C15H21N/c1-11-8-12(2)10-14(9-11)15(16)13-6-4-3-5-7-13/h6,8-10,15H,3-5,7,16H2,1-2H3 |
| InChIKey | AYXLHIXUTLQYLW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|