C12H19N3 — CID 106657216
cyclohexen-1-yl-(2,5-dimethylpyrazol-3-yl)methanamine (PubChem CID 106657216) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,5-dimethylpyrazol-3-yl)methanamine.
| Compound Name | cyclohexen-1-yl-(2,5-dimethylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 106657216 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | cyclohexen-1-yl-(2,5-dimethylpyrazol-3-yl)methanamine |
| SMILES | Cc1cc(C(N)C2=CCCCC2)n(C)n1 |
| InChI | InChI=1S/C12H19N3/c1-9-8-11(15(2)14-9)12(13)10-6-4-3-5-7-10/h6,8,12H,3-5,7,13H2,1-2H3 |
| InChIKey | ZZHJDZUIBWXZAW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|