C16H26N2O — CID 106657733
[(1E)-cycloocten-1-yl]-(1,3-diethylpyrazol-5-yl)methanol (PubChem CID 106657733) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-(1,3-diethylpyrazol-5-yl)methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-(1,3-diethylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 106657733 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-(1,3-diethylpyrazol-5-yl)methanol |
| SMILES | CCc1cc(C(O)/C2=C/CCCCCC2)n(CC)n1 |
| InChI | InChI=1S/C16H26N2O/c1-3-14-12-15(18(4-2)17-14)16(19)13-10-8-6-5-7-9-11-13/h10,12,16,19H,3-9,11H2,1-2H3/b13-10+ |
| InChIKey | ZRBCWCBETNDICX-JLHYYAGUSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|