C11H15N3O3 — CID 106673191
2-amino-3-(3,4-dihydroxypyrrolidin-1-yl)benzamide (PubChem CID 106673191) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxypyrrolidin-1-yl)benzamide.
| Compound Name | 2-amino-3-(3,4-dihydroxypyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 106673191 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxypyrrolidin-1-yl)benzamide |
| SMILES | NC(=O)c1cccc(N2CC(O)C(O)C2)c1N |
| InChI | InChI=1S/C11H15N3O3/c12-10-6(11(13)17)2-1-3-7(10)14-4-8(15)9(16)5-14/h1-3,8-9,15-16H,4-5,12H2,(H2,13,17) |
| InChIKey | SETXPJOHSWXKDI-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|