C11H7N5O2S — CID 106678294
5-nitro-2-([1,3]thiazolo[4,5-b]pyrazin-2-yl)aniline (PubChem CID 106678294) has the molecular formula C11H7N5O2S and a molecular weight of 273.28 g/mol. Its IUPAC name is 5-nitro-2-([1,3]thiazolo[4,5-b]pyrazin-2-yl)aniline.
| Compound Name | 5-nitro-2-([1,3]thiazolo[4,5-b]pyrazin-2-yl)aniline |
|---|---|
| PubChem CID | 106678294 |
| Molecular Formula | C11H7N5O2S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 5-nitro-2-([1,3]thiazolo[4,5-b]pyrazin-2-yl)aniline |
| SMILES | Nc1cc([N+](=O)[O-])ccc1-c1nc2nccnc2s1 |
| InChI | InChI=1S/C11H7N5O2S/c12-8-5-6(16(17)18)1-2-7(8)10-15-9-11(19-10)14-4-3-13-9/h1-5H,12H2 |
| InChIKey | VUDNILSJJQWOCE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|