C14H14Cl2O — CID 106688993
2-chloro-5-[chloro-(2,4,6-trimethylphenyl)methyl]furan (PubChem CID 106688993) has the molecular formula C14H14Cl2O and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-chloro-5-[chloro-(2,4,6-trimethylphenyl)methyl]furan.
| Compound Name | 2-chloro-5-[chloro-(2,4,6-trimethylphenyl)methyl]furan |
|---|---|
| PubChem CID | 106688993 |
| Molecular Formula | C14H14Cl2O |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-chloro-5-[chloro-(2,4,6-trimethylphenyl)methyl]furan |
| SMILES | Cc1cc(C)c(C(Cl)c2ccc(Cl)o2)c(C)c1 |
| InChI | InChI=1S/C14H14Cl2O/c1-8-6-9(2)13(10(3)7-8)14(16)11-4-5-12(15)17-11/h4-7,14H,1-3H3 |
| InChIKey | ALIPCZFMZQIDGQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|