C13H11Cl3O — CID 106689203
2-chloro-5-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]furan (PubChem CID 106689203) has the molecular formula C13H11Cl3O and a molecular weight of 289.59 g/mol. Its IUPAC name is 2-chloro-5-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]furan.
| Compound Name | 2-chloro-5-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]furan |
|---|---|
| PubChem CID | 106689203 |
| Molecular Formula | C13H11Cl3O |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-chloro-5-[chloro-(2-chloro-4,5-dimethylphenyl)methyl]furan |
| SMILES | Cc1cc(Cl)c(C(Cl)c2ccc(Cl)o2)cc1C |
| InChI | InChI=1S/C13H11Cl3O/c1-7-5-9(10(14)6-8(7)2)13(16)11-3-4-12(15)17-11/h3-6,13H,1-2H3 |
| InChIKey | UREVIWCYTRUEES-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|