C26H34O3S — CID 10670128
(2R,4R,9R,13S,14R)-2-hydroxy-5,5,9-trimethyl-14-(phenylsulfanylmethyl)tricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione (PubChem CID 10670128) has the molecular formula C26H34O3S and a molecular weight of 426.62 g/mol. Its IUPAC name is (2R,4R,9R,13S,14R)-2-hydroxy-5,5,9-trimethyl-14-(phenylsulfanylmethyl)tricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione.
| Compound Name | (2R,4R,9R,13S,14R)-2-hydroxy-5,5,9-trimethyl-14-(phenylsulfanylmethyl)tricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione |
|---|---|
| PubChem CID | 10670128 |
| Molecular Formula | C26H34O3S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2R,4R,9R,13S,14R)-2-hydroxy-5,5,9-trimethyl-14-(phenylsulfanylmethyl)tricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione |
| SMILES | CC1(C)CCC[C@@]2(C)C(=O)CC[C@H]3C=C(C(=O)[C@@H]3CSc3ccccc3)[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C26H34O3S/c1-25(2)12-7-13-26(3)22(25)15-21(27)19-14-17(10-11-23(26)28)20(24(19)29)16-30-18-8-5-4-6-9-18/h4-6,8-9,14,17,20-22,27H,7,10-13,15-16H2,1-3H3/t17-,20+,21+,22+,26+/m0/s1 |
| InChIKey | ZGAZLDOAFMUNOH-IHXIMJEQSA-N |
| XLogP | 5.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |