About 7-methylspiro[1,2-dihydroindole-3,3'-oxolane]
7-methylspiro[1,2-dihydroindole-3,3'-oxolane] (PubChem CID 106701925) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 7-methylspiro[1,2-dihydroindole-3,3'-oxolane].
Molecular Properties
| Compound Name | 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] |
| PubChem CID | 106701925 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] |
| SMILES | Cc1cccc2c1NCC21CCOC1 |
| InChI | InChI=1S/C12H15NO/c1-9-3-2-4-10-11(9)13-7-12(10)5-6-14-8-12/h2-4,13H,5-8H2,1H3 |
| InChIKey | GFYUXFQMHVDIFH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylspiro[1,2-dihydroindole-3,3'-oxolane]?
The IUPAC name of 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] (CID 106701925) is 7-methylspiro[1,2-dihydroindole-3,3'-oxolane].
What is the SMILES notation for 7-methylspiro[1,2-dihydroindole-3,3'-oxolane]?
The canonical SMILES for 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] is Cc1cccc2c1NCC21CCOC1.
What is the InChIKey of 7-methylspiro[1,2-dihydroindole-3,3'-oxolane]?
The InChIKey is GFYUXFQMHVDIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-9-3-2-4-10-11(9)13-7-12(10)5-6-14-8-12/h2-4,13H,5-8H2,1H3.
What are the key properties of 7-methylspiro[1,2-dihydroindole-3,3'-oxolane]?
7-methylspiro[1,2-dihydroindole-3,3'-oxolane] has a molecular weight of 189.26 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] is sourced from PubChem (CID 106701925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).