C12H15NO — CID 106701925
7-methylspiro[1,2-dihydroindole-3,3'-oxolane] (PubChem CID 106701925) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 7-methylspiro[1,2-dihydroindole-3,3'-oxolane].
| Compound Name | 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] |
|---|---|
| PubChem CID | 106701925 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 7-methylspiro[1,2-dihydroindole-3,3'-oxolane] |
| SMILES | Cc1cccc2c1NCC21CCOC1 |
| InChI | InChI=1S/C12H15NO/c1-9-3-2-4-10-11(9)13-7-12(10)5-6-14-8-12/h2-4,13H,5-8H2,1H3 |
| InChIKey | GFYUXFQMHVDIFH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |