C18H27N3O7S — CID 10670246
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[(2-methoxyacetyl)amino]pyrrolidine-2-carboxamide (PubChem CID 10670246) has the molecular formula C18H27N3O7S and a molecular weight of 429.50 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[(2-methoxyacetyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[(2-methoxyacetyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10670246 |
| Molecular Formula | C18H27N3O7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[(2-methoxyacetyl)amino]pyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](NC(=O)COC)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C18H27N3O7S/c1-3-4-9-28-14-5-7-15(8-6-14)29(25,26)21-11-13(19-17(22)12-27-2)10-16(21)18(23)20-24/h5-8,13,16,24H,3-4,9-12H2,1-2H3,(H,19,22)(H,20,23)/t13-,16+/m0/s1 |
| InChIKey | YUFOYANNKICWEX-XJKSGUPXSA-N |
| XLogP | 0.27 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|