C23H27N5O4 — CID 10670614
[4-[methyl-(3-propan-2-yloxy-2-pyridinyl)amino]piperidin-1-yl]-(5-nitro-1H-indol-2-yl)methanone (PubChem CID 10670614) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-[methyl-(3-propan-2-yloxy-2-pyridinyl)amino]piperidin-1-yl]-(5-nitro-1H-indol-2-yl)methanone.
| Compound Name | [4-[methyl-(3-propan-2-yloxy-2-pyridinyl)amino]piperidin-1-yl]-(5-nitro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 10670614 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | [4-[methyl-(3-propan-2-yloxy-2-pyridinyl)amino]piperidin-1-yl]-(5-nitro-1H-indol-2-yl)methanone |
| SMILES | CC(C)Oc1cccnc1N(C)C1CCN(C(=O)c2cc3cc([N+](=O)[O-])ccc3[nH]2)CC1 |
| InChI | InChI=1S/C23H27N5O4/c1-15(2)32-21-5-4-10-24-22(21)26(3)17-8-11-27(12-9-17)23(29)20-14-16-13-18(28(30)31)6-7-19(16)25-20/h4-7,10,13-15,17,25H,8-9,11-12H2,1-3H3 |
| InChIKey | SLNWTMXLZYQDTN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|