C21H20BrN5O4 — CID 155968894
N-[1-[(4-bromophenyl)carbamoyl]piperidin-4-yl]-5-nitro-1H-indole-2-carboxamide (PubChem CID 155968894) has the molecular formula C21H20BrN5O4 and a molecular weight of 486.33 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)carbamoyl]piperidin-4-yl]-5-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[1-[(4-bromophenyl)carbamoyl]piperidin-4-yl]-5-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155968894 |
| Molecular Formula | C21H20BrN5O4 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-[1-[(4-bromophenyl)carbamoyl]piperidin-4-yl]-5-nitro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccc(Br)cc2)CC1)c1cc2cc([N+](=O)[O-])ccc2[nH]1 |
| InChI | InChI=1S/C21H20BrN5O4/c22-14-1-3-15(4-2-14)24-21(29)26-9-7-16(8-10-26)23-20(28)19-12-13-11-17(27(30)31)5-6-18(13)25-19/h1-6,11-12,16,25H,7-10H2,(H,23,28)(H,24,29) |
| InChIKey | QSWYDRXPVUOFCK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|