C20H20BrClN4O — CID 122435985
[4-[2-(4-bromophenyl)hydrazinyl]piperidin-1-yl]-(5-chloro-1H-indol-2-yl)methanone (PubChem CID 122435985) has the molecular formula C20H20BrClN4O and a molecular weight of 447.76 g/mol. Its IUPAC name is [4-[2-(4-bromophenyl)hydrazinyl]piperidin-1-yl]-(5-chloro-1H-indol-2-yl)methanone.
| Compound Name | [4-[2-(4-bromophenyl)hydrazinyl]piperidin-1-yl]-(5-chloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 122435985 |
| Molecular Formula | C20H20BrClN4O |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [4-[2-(4-bromophenyl)hydrazinyl]piperidin-1-yl]-(5-chloro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2cc(Cl)ccc2[nH]1)N1CCC(NNc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H20BrClN4O/c21-14-1-4-16(5-2-14)24-25-17-7-9-26(10-8-17)20(27)19-12-13-11-15(22)3-6-18(13)23-19/h1-6,11-12,17,23-25H,7-10H2 |
| InChIKey | UKAHOHCDCVZBAR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|