About 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione
2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione (PubChem CID 106708339) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione |
| PubChem CID | 106708339 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione |
| SMILES | CC(C)(CN)CCCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C12H21N3O2/c1-12(2,9-13)7-3-4-8-15-11(17)6-5-10(16)14-15/h5-6H,3-4,7-9,13H2,1-2H3,(H,14,16) |
| InChIKey | QSGNBPTUGGAJJI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione?
The IUPAC name of 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione (CID 106708339) is 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione is CC(C)(CN)CCCCn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione?
The InChIKey is QSGNBPTUGGAJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-12(2,9-13)7-3-4-8-15-11(17)6-5-10(16)14-15/h5-6H,3-4,7-9,13H2,1-2H3,(H,14,16).
What are the key properties of 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione?
2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione has a molecular weight of 239.32 g/mol, XLogP of 0.69, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-5,5-dimethylhexyl)-1H-pyridazine-3,6-dione is sourced from PubChem (CID 106708339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).