C12H20N2O2S2 — CID 121003720
2-[3,3-bis(ethylsulfanyl)butyl]-1H-pyridazine-3,6-dione (PubChem CID 121003720) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[3,3-bis(ethylsulfanyl)butyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[3,3-bis(ethylsulfanyl)butyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 121003720 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[3,3-bis(ethylsulfanyl)butyl]-1H-pyridazine-3,6-dione |
| SMILES | CCSC(C)(CCn1[nH]c(=O)ccc1=O)SCC |
| InChI | InChI=1S/C12H20N2O2S2/c1-4-17-12(3,18-5-2)8-9-14-11(16)7-6-10(15)13-14/h6-7H,4-5,8-9H2,1-3H3,(H,13,15) |
| InChIKey | NRGGLMHGZXEECY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|