C13H22N2O — CID 106708399
1-(6-amino-5,5-dimethylhexyl)pyridin-4-one (PubChem CID 106708399) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)pyridin-4-one.
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)pyridin-4-one |
|---|---|
| PubChem CID | 106708399 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)pyridin-4-one |
| SMILES | CC(C)(CN)CCCCn1ccc(=O)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-13(2,11-14)7-3-4-8-15-9-5-12(16)6-10-15/h5-6,9-10H,3-4,7-8,11,14H2,1-2H3 |
| InChIKey | YTSHRVDIDBDTQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|