C11H15F6NO — CID 106710553
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylhexanenitrile (PubChem CID 106710553) has the molecular formula C11H15F6NO and a molecular weight of 291.24 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710553 |
| Molecular Formula | C11H15F6NO |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6NO/c1-9(2,7-18)5-3-4-6-19-8(10(12,13)14)11(15,16)17/h8H,3-6H2,1-2H3 |
| InChIKey | LCQGAGAMNXKUFT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|