About 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde
1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde (PubChem CID 106716494) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde |
| PubChem CID | 106716494 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde |
| SMILES | CCc1cc(Cn2cnc(C=O)c2)n(CC)n1 |
| InChI | InChI=1S/C12H16N4O/c1-3-10-5-12(16(4-2)14-10)7-15-6-11(8-17)13-9-15/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | GGOQBVRSHQLLPN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde?
The IUPAC name of 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde (CID 106716494) is 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde.
What is the SMILES notation for 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde?
The canonical SMILES for 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde is CCc1cc(Cn2cnc(C=O)c2)n(CC)n1.
What is the InChIKey of 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde?
The InChIKey is GGOQBVRSHQLLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-3-10-5-12(16(4-2)14-10)7-15-6-11(8-17)13-9-15/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde?
1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde has a molecular weight of 232.29 g/mol, XLogP of 1.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3-diethylpyrazol-5-yl)methyl]imidazole-4-carbaldehyde is sourced from PubChem (CID 106716494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).