C27H30N2O4S — CID 10672321
6-[(E)-N-(methanesulfonamido)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-2-carboxylic acid (PubChem CID 10672321) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 6-[(E)-N-(methanesulfonamido)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[(E)-N-(methanesulfonamido)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 10672321 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 6-[(E)-N-(methanesulfonamido)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]naphthalene-2-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C(=N/NS(C)(=O)=O)c3ccc4cc(C(=O)O)ccc4c3)ccc21 |
| InChI | InChI=1S/C27H30N2O4S/c1-26(2)12-13-27(3,4)23-16-20(10-11-22(23)26)24(28-29-34(5,32)33)19-8-6-18-15-21(25(30)31)9-7-17(18)14-19/h6-11,14-16,29H,12-13H2,1-5H3,(H,30,31)/b28-24+ |
| InChIKey | AFXUXZQUPCCJSH-ZZIIXHQDSA-N |
| XLogP | 5.19 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|