C26H28N2O2 — CID 10668711
6-[(Z)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]naphthalene-2-carboxylic acid (PubChem CID 10668711) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 6-[(Z)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[(Z)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 10668711 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 6-[(Z)-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]naphthalene-2-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C(=N\N)c3ccc4cc(C(=O)O)ccc4c3)ccc21 |
| InChI | InChI=1S/C26H28N2O2/c1-25(2)11-12-26(3,4)22-15-19(9-10-21(22)25)23(28-27)18-7-5-17-14-20(24(29)30)8-6-16(17)13-18/h5-10,13-15H,11-12,27H2,1-4H3,(H,29,30)/b28-23- |
| InChIKey | BZKPZJRFQBJMJF-NFFVHWSESA-N |
| XLogP | 5.60 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|