C27H32O4S2 — CID 10672518
[(2S,3R)-3-benzoyloxy-6-(1,3-dithian-2-ylidene)-2-ethylheptyl] benzoate (PubChem CID 10672518) has the molecular formula C27H32O4S2 and a molecular weight of 484.68 g/mol. Its IUPAC name is [(2S,3R)-3-benzoyloxy-6-(1,3-dithian-2-ylidene)-2-ethylheptyl] benzoate.
| Compound Name | [(2S,3R)-3-benzoyloxy-6-(1,3-dithian-2-ylidene)-2-ethylheptyl] benzoate |
|---|---|
| PubChem CID | 10672518 |
| Molecular Formula | C27H32O4S2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [(2S,3R)-3-benzoyloxy-6-(1,3-dithian-2-ylidene)-2-ethylheptyl] benzoate |
| SMILES | CC[C@@H](COC(=O)c1ccccc1)[C@@H](CCC(C)=C1SCCCS1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H32O4S2/c1-3-21(19-30-25(28)22-11-6-4-7-12-22)24(31-26(29)23-13-8-5-9-14-23)16-15-20(2)27-32-17-10-18-33-27/h4-9,11-14,21,24H,3,10,15-19H2,1-2H3/t21-,24+/m0/s1 |
| InChIKey | LLXADNWVILUWJJ-XUZZJYLKSA-N |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |