C26H36O9 — CID 10672767
[(Z)-4-[(1S,4R,4aS,6R)-6-acetyloxy-4-(6-acetyloxyhept-1-en-2-yl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-1-yl]-2-methylbut-2-enyl] acetate (PubChem CID 10672767) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(Z)-4-[(1S,4R,4aS,6R)-6-acetyloxy-4-(6-acetyloxyhept-1-en-2-yl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-1-yl]-2-methylbut-2-enyl] acetate.
| Compound Name | [(Z)-4-[(1S,4R,4aS,6R)-6-acetyloxy-4-(6-acetyloxyhept-1-en-2-yl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-1-yl]-2-methylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 10672767 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(Z)-4-[(1S,4R,4aS,6R)-6-acetyloxy-4-(6-acetyloxyhept-1-en-2-yl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-1-yl]-2-methylbut-2-enyl] acetate |
| SMILES | C=C(CCCC(C)OC(C)=O)[C@@H]1C(=O)O[C@@H](C/C=C(/C)COC(C)=O)C2=CO[C@H](OC(C)=O)C[C@H]21 |
| InChI | InChI=1S/C26H36O9/c1-15(13-31-18(4)27)10-11-23-22-14-32-24(34-20(6)29)12-21(22)25(26(30)35-23)16(2)8-7-9-17(3)33-19(5)28/h10,14,17,21,23-25H,2,7-9,11-13H2,1,3-6H3/b15-10-/t17?,21-,23+,24-,25+/m1/s1 |
| InChIKey | MHJDVIISCVSRNK-HIRNCVQRSA-N |
| XLogP | 3.92 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|