C12H17F2NO3S2 — CID 106728965
4-(2-tert-butylsulfonylethylsulfinyl)-3,5-difluoroaniline (PubChem CID 106728965) has the molecular formula C12H17F2NO3S2 and a molecular weight of 325.40 g/mol. Its IUPAC name is 4-(2-tert-butylsulfonylethylsulfinyl)-3,5-difluoroaniline.
| Compound Name | 4-(2-tert-butylsulfonylethylsulfinyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 106728965 |
| Molecular Formula | C12H17F2NO3S2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-(2-tert-butylsulfonylethylsulfinyl)-3,5-difluoroaniline |
| SMILES | CC(C)(C)S(=O)(=O)CCS(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H17F2NO3S2/c1-12(2,3)20(17,18)5-4-19(16)11-9(13)6-8(15)7-10(11)14/h6-7H,4-5,15H2,1-3H3 |
| InChIKey | HBDQRFGTXZWBJT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|