C12H17F2NOS — CID 83161624
3,5-difluoro-4-(4-methylpentylsulfinyl)aniline (PubChem CID 83161624) has the molecular formula C12H17F2NOS and a molecular weight of 261.34 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-methylpentylsulfinyl)aniline.
| Compound Name | 3,5-difluoro-4-(4-methylpentylsulfinyl)aniline |
|---|---|
| PubChem CID | 83161624 |
| Molecular Formula | C12H17F2NOS |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3,5-difluoro-4-(4-methylpentylsulfinyl)aniline |
| SMILES | CC(C)CCCS(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H17F2NOS/c1-8(2)4-3-5-17(16)12-10(13)6-9(15)7-11(12)14/h6-8H,3-5,15H2,1-2H3 |
| InChIKey | JKQVLMUOEHFUHP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|