C13H24FNO2S — CID 106735920
3-(2-tert-butylsulfonylethyl)-3-fluoro-8-azabicyclo[3.2.1]octane (PubChem CID 106735920) has the molecular formula C13H24FNO2S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-(2-tert-butylsulfonylethyl)-3-fluoro-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-(2-tert-butylsulfonylethyl)-3-fluoro-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 106735920 |
| Molecular Formula | C13H24FNO2S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-(2-tert-butylsulfonylethyl)-3-fluoro-8-azabicyclo[3.2.1]octane |
| SMILES | CC(C)(C)S(=O)(=O)CCC1(F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H24FNO2S/c1-12(2,3)18(16,17)7-6-13(14)8-10-4-5-11(9-13)15-10/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | ZRUQKISCYVJNNM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |