C12H22F3NO2S — CID 105174416
1-(1,1-dioxothiolan-3-yl)-N-ethyl-6,6,6-trifluorohexan-2-amine (PubChem CID 105174416) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-ethyl-6,6,6-trifluorohexan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-6,6,6-trifluorohexan-2-amine |
|---|---|
| PubChem CID | 105174416 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-ethyl-6,6,6-trifluorohexan-2-amine |
| SMILES | CCNC(CCCC(F)(F)F)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22F3NO2S/c1-2-16-11(4-3-6-12(13,14)15)8-10-5-7-19(17,18)9-10/h10-11,16H,2-9H2,1H3 |
| InChIKey | OQYWQFBZVPWEOJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |