C29H47NO6Si — CID 10673862
[(5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-methyl-7-oxo-5-triethylsilyloxyheptyl] 2,2-dimethylpropanoate (PubChem CID 10673862) has the molecular formula C29H47NO6Si and a molecular weight of 533.78 g/mol. Its IUPAC name is [(5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-methyl-7-oxo-5-triethylsilyloxyheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-methyl-7-oxo-5-triethylsilyloxyheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10673862 |
| Molecular Formula | C29H47NO6Si |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | [(5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-6-methyl-7-oxo-5-triethylsilyloxyheptyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCCCOC(=O)C(C)(C)C)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H47NO6Si/c1-8-37(9-2,10-3)36-25(18-14-15-19-34-27(32)29(5,6)7)22(4)26(31)30-24(21-35-28(30)33)20-23-16-12-11-13-17-23/h11-13,16-17,22,24-25H,8-10,14-15,18-21H2,1-7H3/t22-,24-,25+/m0/s1 |
| InChIKey | DMUBDLQVOSDMDG-ZKMPZPQNSA-N |
| XLogP | 6.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|