C24H33NO13S — CID 10674666
(2,5-dioxopyrrolidin-1-yl) 6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylhexanoate (PubChem CID 10674666) has the molecular formula C24H33NO13S and a molecular weight of 575.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylhexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 10674666 |
| Molecular Formula | C24H33NO13S |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylhexanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCCCCC(=O)ON2C(=O)CCC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H33NO13S/c1-13(26)33-12-17-21(34-14(2)27)22(35-15(3)28)23(36-16(4)29)24(37-17)39-11-7-5-6-8-20(32)38-25-18(30)9-10-19(25)31/h17,21-24H,5-12H2,1-4H3/t17-,21-,22+,23-,24+/m1/s1 |
| InChIKey | ZSFPORWHFRLLNK-JCTDHXFVSA-N |
| XLogP | 0.97 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|