C32H40O8S2 — CID 10675313
(4S,6R,7S,11S,15R)-15-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10675313) has the molecular formula C32H40O8S2 and a molecular weight of 616.80 g/mol. Its IUPAC name is (4S,6R,7S,11S,15R)-15-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (4S,6R,7S,11S,15R)-15-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10675313 |
| Molecular Formula | C32H40O8S2 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | (4S,6R,7S,11S,15R)-15-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | CC1(C)OC[C@H]([C@H](O)[C@H]2O[C@@]3(CCC[C@@H](CSc4ccccc4)O3)[C@]3(CCC[C@@H](CSc4ccccc4)O3)OC2=O)O1 |
| InChI | InChI=1S/C32H40O8S2/c1-30(2)35-19-26(38-30)27(33)28-29(34)40-32(18-10-12-23(37-32)21-42-25-15-7-4-8-16-25)31(39-28)17-9-11-22(36-31)20-41-24-13-5-3-6-14-24/h3-8,13-16,22-23,26-28,33H,9-12,17-21H2,1-2H3/t22-,23-,26+,27-,28+,31-,32-/m0/s1 |
| InChIKey | HNKPMIHSWRJDCS-KGQBDBHJSA-N |
| XLogP | 5.56 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |