C29H34O6S2 — CID 10816321
(4R,6S,7R,11R,15R)-15-[(1R)-1-hydroxyprop-2-enyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10816321) has the molecular formula C29H34O6S2 and a molecular weight of 542.72 g/mol. Its IUPAC name is (4R,6S,7R,11R,15R)-15-[(1R)-1-hydroxyprop-2-enyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (4R,6S,7R,11R,15R)-15-[(1R)-1-hydroxyprop-2-enyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10816321 |
| Molecular Formula | C29H34O6S2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (4R,6S,7R,11R,15R)-15-[(1R)-1-hydroxyprop-2-enyl]-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | C=C[C@@H](O)[C@H]1O[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)OC1=O |
| InChI | InChI=1S/C29H34O6S2/c1-2-25(30)26-27(31)35-29(18-10-12-22(33-29)20-37-24-15-7-4-8-16-24)28(34-26)17-9-11-21(32-28)19-36-23-13-5-3-6-14-23/h2-8,13-16,21-22,25-26,30H,1,9-12,17-20H2/t21-,22-,25-,26-,28-,29-/m1/s1 |
| InChIKey | VCXFADHEKOJBOB-CKIDCGGYSA-N |
| XLogP | 5.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|