C26H30O5S2 — CID 10719734
(4S,6R,7S,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one (PubChem CID 10719734) has the molecular formula C26H30O5S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (4S,6R,7S,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one.
| Compound Name | (4S,6R,7S,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
|---|---|
| PubChem CID | 10719734 |
| Molecular Formula | C26H30O5S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (4S,6R,7S,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-one |
| SMILES | O=C1CO[C@@]2(CCC[C@@H](CSc3ccccc3)O2)[C@]2(CCC[C@@H](CSc3ccccc3)O2)O1 |
| InChI | InChI=1S/C26H30O5S2/c27-24-17-28-25(15-7-9-20(29-25)18-32-22-11-3-1-4-12-22)26(31-24)16-8-10-21(30-26)19-33-23-13-5-2-6-14-23/h1-6,11-14,20-21H,7-10,15-19H2/t20-,21-,25+,26-/m0/s1 |
| InChIKey | CHJJCJLSCBXSQC-MSNAGZIKSA-N |
| XLogP | 5.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |