C23H28O2S2 — CID 11069423
(2S,8S)-2,8-bis(phenylsulfanylmethyl)-1,7-dioxaspiro[5.5]undecane (PubChem CID 11069423) has the molecular formula C23H28O2S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (2S,8S)-2,8-bis(phenylsulfanylmethyl)-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2S,8S)-2,8-bis(phenylsulfanylmethyl)-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 11069423 |
| Molecular Formula | C23H28O2S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2S,8S)-2,8-bis(phenylsulfanylmethyl)-1,7-dioxaspiro[5.5]undecane |
| SMILES | c1ccc(SC[C@@H]2CCCC3(CCC[C@@H](CSc4ccccc4)O3)O2)cc1 |
| InChI | InChI=1S/C23H28O2S2/c1-3-11-21(12-4-1)26-17-19-9-7-15-23(24-19)16-8-10-20(25-23)18-27-22-13-5-2-6-14-22/h1-6,11-14,19-20H,7-10,15-18H2/t19-,20-,23?/m0/s1 |
| InChIKey | DAPCYTWCKQKVEX-ZXTYOHMPSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |