C26H32O4S2 — CID 101038434
(4S,6S,7R,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane (PubChem CID 101038434) has the molecular formula C26H32O4S2 and a molecular weight of 472.67 g/mol. Its IUPAC name is (4S,6S,7R,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane.
| Compound Name | (4S,6S,7R,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane |
|---|---|
| PubChem CID | 101038434 |
| Molecular Formula | C26H32O4S2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (4S,6S,7R,11S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane |
| SMILES | c1ccc(SC[C@@H]2CCC[C@]3(OCCO[C@@]34CCC[C@@H](CSc3ccccc3)O4)O2)cc1 |
| InChI | InChI=1S/C26H32O4S2/c1-3-11-23(12-4-1)31-19-21-9-7-15-25(29-21)26(28-18-17-27-25)16-8-10-22(30-26)20-32-24-13-5-2-6-14-24/h1-6,11-14,21-22H,7-10,15-20H2/t21-,22-,25-,26+/m0/s1 |
| InChIKey | RHAIJPQPJZEYOC-LIOHBJMPSA-N |
| XLogP | 6.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |